CAS 1881296-01-0 is the registry number for 2-(benzyloxy)-5-chloro-1,3-difluorobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-chloro-1,3-difluoro-2-phenylmethoxybenzene (CAS 1881296-01-0) is a chemical compound with the molecular formula C13H9ClF2O and a molecular weight of 254.66 g/mol. IUPAC name: 5-chloro-1,3-difluoro-2-phenylmethoxybenzene. InChIKey: TUAGVRJKSBGCMU-UHFFFAOYSA-N.
| Molecular formula | C13H9ClF2O |
|---|---|
| Molecular weight | 254.66 g/mol |
| IUPAC name | 5-chloro-1,3-difluoro-2-phenylmethoxybenzene |
| InChIKey | TUAGVRJKSBGCMU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2F)Cl)F |
Computed by PubChem (NCBI)