Products 1881289-27-5
CAS 1881289-27-5 appears in our catalog under these names: 1-(benzyloxy)-3-chloro-2,4-difluorobenzene, 95%, 1-(Benzyloxy)-3-chloro-2,4-difluorobenzene, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-chloro-1,3-difluoro-4-phenylmethoxybenzene (CAS 1881289-27-5) is a chemical compound with the molecular formula C13H9ClF2O and a molecular weight of 254.66 g/mol. IUPAC name: 2-chloro-1,3-difluoro-4-phenylmethoxybenzene. InChIKey: GLBZQNFCJHEXJZ-UHFFFAOYSA-N.
| Molecular formula | C13H9ClF2O |
|---|---|
| Molecular weight | 254.66 g/mol |
| IUPAC name | 2-chloro-1,3-difluoro-4-phenylmethoxybenzene |
| InChIKey | GLBZQNFCJHEXJZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=C(C=C2)F)Cl)F |
Computed by PubChem (NCBI)