Products 1881322-24-2
CAS 1881322-24-2 is the registry number for 1,3-difluoro-4-methyl-5-nitro-2-propoxybenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,3-difluoro-4-methyl-5-nitro-2-propoxybenzene (CAS 1881322-24-2) is a chemical compound with the molecular formula C10H11F2NO3 and a molecular weight of 231.20 g/mol. IUPAC name: 1,3-difluoro-4-methyl-5-nitro-2-propoxybenzene. InChIKey: YEOWNIOMHDHUNQ-UHFFFAOYSA-N.
| Molecular formula | C10H11F2NO3 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | 1,3-difluoro-4-methyl-5-nitro-2-propoxybenzene |
| InChIKey | YEOWNIOMHDHUNQ-UHFFFAOYSA-N |
| SMILES | CCCOC1=C(C=C(C(=C1F)C)[N+](=O)[O-])F |
Computed by PubChem (NCBI)