CAS 1256482-63-9 is the registry number for 2,3-Difluoro-4-methoxy-dl-phenylalanine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-amino-3-(2,3-difluoro-4-methoxyphenyl)propanoic acid (CAS 1256482-63-9) is a chemical compound with the molecular formula C10H11F2NO3 and a molecular weight of 231.20 g/mol. IUPAC name: 2-amino-3-(2,3-difluoro-4-methoxyphenyl)propanoic acid. InChIKey: PQCGRBWGXKGWIG-UHFFFAOYSA-N.
| Molecular formula | C10H11F2NO3 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | 2-amino-3-(2,3-difluoro-4-methoxyphenyl)propanoic acid |
| InChIKey | PQCGRBWGXKGWIG-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)CC(C(=O)O)N)F)F |
Computed by PubChem (NCBI)