Products 887355-01-3

CAS 887355-01-3 is the registry number for 2,2-Difluoro-3-hydroxy-3-pyridin-3-yl-propionic acid ethyl ester, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 2,2-difluoro-3-hydroxy-3-pyridin-3-ylpropanoate (CAS 887355-01-3) is a chemical compound with the molecular formula C10H11F2NO3 and a molecular weight of 231.20 g/mol. IUPAC name: ethyl 2,2-difluoro-3-hydroxy-3-pyridin-3-ylpropanoate. InChIKey: QGXNEWUXMADUTQ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11F2NO3
Molecular weight231.20 g/mol
IUPAC nameethyl 2,2-difluoro-3-hydroxy-3-pyridin-3-ylpropanoate
InChIKeyQGXNEWUXMADUTQ-UHFFFAOYSA-N
SMILESCCOC(=O)C(C(C1=CN=CC=C1)O)(F)F

Computed by PubChem (NCBI)