Products 1050886-21-9
CAS 1050886-21-9 is the registry number for N-(1-[4-(Difluoromethoxy)-3-methoxyphenyl]ethylidene)hydroxylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(NE)-N-[1-[4-(difluoromethoxy)-3-methoxyphenyl]ethylidene]hydroxylamine (CAS 1050886-21-9) is a chemical compound with the molecular formula C10H11F2NO3 and a molecular weight of 231.20 g/mol. IUPAC name: (NE)-N-[1-[4-(difluoromethoxy)-3-methoxyphenyl]ethylidene]hydroxylamine. InChIKey: SRDXBYYFFZMRDX-AWNIVKPZSA-N.
| Molecular formula | C10H11F2NO3 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | (NE)-N-[1-[4-(difluoromethoxy)-3-methoxyphenyl]ethylidene]hydroxylamine |
| InChIKey | SRDXBYYFFZMRDX-AWNIVKPZSA-N |
| SMILES | C/C(=N\O)/C1=CC(=C(C=C1)OC(F)F)OC |
Computed by PubChem (NCBI)