CAS 1881328-81-9 is the registry number for 2-methoxy-3-nitropyridine hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-methoxy-3-nitropyridine;hydrate (CAS 1881328-81-9) is a chemical compound with the molecular formula C6H8N2O4 and a molecular weight of 172.14 g/mol. IUPAC name: 2-methoxy-3-nitropyridine;hydrate. InChIKey: MBZDAMWICKMLKA-UHFFFAOYSA-N.
| Molecular formula | C6H8N2O4 |
|---|---|
| Molecular weight | 172.14 g/mol |
| IUPAC name | 2-methoxy-3-nitropyridine;hydrate |
| InChIKey | MBZDAMWICKMLKA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC=N1)[N+](=O)[O-].O |
Computed by PubChem (NCBI)