CAS 17027-50-8 appears in our catalog under these names: 3-[(4S)-2,5-Dioxo-4-imidazolidinyl]propanoic acid, 95%, Carglumic Acid Impurity B, L-Hydantoin-5-propionic Acid, >95% (HPLC). Offered by: Combi-blocks, Chemat Brand, TRC. Available pack sizes: 25g, 10g, 5g, 1g, on request, 100mg.
3-[(4S)-2,5-dioxoimidazolidin-4-yl]propanoic acid (CAS 17027-50-8) is a chemical compound with the molecular formula C6H8N2O4 and a molecular weight of 172.14 g/mol. IUPAC name: 3-[(4S)-2,5-dioxoimidazolidin-4-yl]propanoic acid. InChIKey: VWFWNXQAMGDPGG-VKHMYHEASA-N.
| Molecular formula | C6H8N2O4 |
|---|---|
| Molecular weight | 172.14 g/mol |
| IUPAC name | 3-[(4S)-2,5-dioxoimidazolidin-4-yl]propanoic acid |
| InChIKey | VWFWNXQAMGDPGG-VKHMYHEASA-N |
| SMILES | C(CC(=O)O)[C@H]1C(=O)NC(=O)N1 |
Computed by PubChem (NCBI)