CAS 39681-15-7 is the registry number for methyl (4S)-2,6-dioxo-1,3-diazinane-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl (4S)-2,6-dioxo-1,3-diazinane-4-carboxylate (CAS 39681-15-7) is a chemical compound with the molecular formula C6H8N2O4 and a molecular weight of 172.14 g/mol. IUPAC name: methyl (4S)-2,6-dioxo-1,3-diazinane-4-carboxylate. InChIKey: LRRONAYCHITNSG-VKHMYHEASA-N.
| Molecular formula | C6H8N2O4 |
|---|---|
| Molecular weight | 172.14 g/mol |
| IUPAC name | methyl (4S)-2,6-dioxo-1,3-diazinane-4-carboxylate |
| InChIKey | LRRONAYCHITNSG-VKHMYHEASA-N |
| SMILES | COC(=O)[C@@H]1CC(=O)NC(=O)N1 |
Computed by PubChem (NCBI)