CAS 52661-97-9 appears in our catalog under these names: Cyclo(-asp-gly), 95%, (S)-2-(3,6-dioxopiperazin-2-yl)acetic acid, Cyclo(–Asp–Gly), Cyclo(-asp-gly). Offered by: Combi-blocks, TRC, GLPBio, MedChemExpress. Available pack sizes: 100mg, 250mg, 500mg, 1g, Get quote.
2-[(2S)-3,6-dioxopiperazin-2-yl]acetic acid (CAS 52661-97-9) is a chemical compound with the molecular formula C6H8N2O4 and a molecular weight of 172.14 g/mol. IUPAC name: 2-[(2S)-3,6-dioxopiperazin-2-yl]acetic acid. InChIKey: STTIAONCINEOLF-VKHMYHEASA-N.
| Molecular formula | C6H8N2O4 |
|---|---|
| Molecular weight | 172.14 g/mol |
| IUPAC name | 2-[(2S)-3,6-dioxopiperazin-2-yl]acetic acid |
| InChIKey | STTIAONCINEOLF-VKHMYHEASA-N |
| SMILES | C1C(=O)N[C@H](C(=O)N1)CC(=O)O |
Computed by PubChem (NCBI)