Products 1881331-96-9
CAS 1881331-96-9 is the registry number for 2,4-difluoro-3-methoxy-1-methyl-5-nitrobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,4-difluoro-3-methoxy-1-methyl-5-nitrobenzene (CAS 1881331-96-9) is a chemical compound with the molecular formula C8H7F2NO3 and a molecular weight of 203.14 g/mol. IUPAC name: 2,4-difluoro-3-methoxy-1-methyl-5-nitrobenzene. InChIKey: KPNBJASTMJDLBH-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO3 |
|---|---|
| Molecular weight | 203.14 g/mol |
| IUPAC name | 2,4-difluoro-3-methoxy-1-methyl-5-nitrobenzene |
| InChIKey | KPNBJASTMJDLBH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1F)OC)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)