CAS 1386942-96-6 is the registry number for 1-ethoxy-2,3-difluoro-4-nitrobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-ethoxy-2,3-difluoro-4-nitrobenzene (CAS 1386942-96-6) is a chemical compound with the molecular formula C8H7F2NO3 and a molecular weight of 203.14 g/mol. IUPAC name: 1-ethoxy-2,3-difluoro-4-nitrobenzene. InChIKey: VUCWHNVRSUUSKP-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO3 |
|---|---|
| Molecular weight | 203.14 g/mol |
| IUPAC name | 1-ethoxy-2,3-difluoro-4-nitrobenzene |
| InChIKey | VUCWHNVRSUUSKP-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)[N+](=O)[O-])F)F |
Computed by PubChem (NCBI)