Products 1072855-41-4

CAS 1072855-41-4 appears in our catalog under these names: 6-(2,2-Difluoroethoxy)pyridine-3-carboxylic acid, 95%, 6-(2,2-Difluoroethoxy)pyridine-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

6-(2,2-difluoroethoxy)pyridine-3-carboxylic acid (CAS 1072855-41-4) is a chemical compound with the molecular formula C8H7F2NO3 and a molecular weight of 203.14 g/mol. IUPAC name: 6-(2,2-difluoroethoxy)pyridine-3-carboxylic acid. InChIKey: CJWFZYNDCTZHEP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7F2NO3
Molecular weight203.14 g/mol
IUPAC name6-(2,2-difluoroethoxy)pyridine-3-carboxylic acid
InChIKeyCJWFZYNDCTZHEP-UHFFFAOYSA-N
SMILESC1=CC(=NC=C1C(=O)O)OCC(F)F

Computed by PubChem (NCBI)