CAS 795303-16-1 appears in our catalog under these names: 4–(Difluoromethoxy)–2–methyl–1–nitrobenzene, 4-(Difluoromethoxy)-2-methyl-1-nitrobenzene, 95%, 4-(Difluoromethoxy)-2-methyl-1-nitrobenzene, 95+%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 5g.
4-(difluoromethoxy)-2-methyl-1-nitrobenzene (CAS 795303-16-1) is a chemical compound with the molecular formula C8H7F2NO3 and a molecular weight of 203.14 g/mol. IUPAC name: 4-(difluoromethoxy)-2-methyl-1-nitrobenzene. InChIKey: ZMQMGYRUUZPIOD-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO3 |
|---|---|
| Molecular weight | 203.14 g/mol |
| IUPAC name | 4-(difluoromethoxy)-2-methyl-1-nitrobenzene |
| InChIKey | ZMQMGYRUUZPIOD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OC(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)