CAS 188399-48-6 is the registry number for (1R,2S)-2-(Benzyloxy)methyl-3-cyclopenten-1-ol. Offered by: TRC. Available pack sizes: 250mg, 25mg.
(1R,2S)-2-(phenylmethoxymethyl)cyclopent-3-en-1-ol (CAS 188399-48-6) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: (1R,2S)-2-(phenylmethoxymethyl)cyclopent-3-en-1-ol. InChIKey: WACMQXMZXZTKIV-QWHCGFSZSA-N.
| Molecular formula | C13H16O2 |
|---|---|
| Molecular weight | 204.26 g/mol |
| IUPAC name | (1R,2S)-2-(phenylmethoxymethyl)cyclopent-3-en-1-ol |
| InChIKey | WACMQXMZXZTKIV-QWHCGFSZSA-N |
| SMILES | C1C=C[C@H]([C@@H]1O)COCC2=CC=CC=C2 |
Computed by PubChem (NCBI)