Products 1884230-69-6
CAS 1884230-69-6 appears in our catalog under these names: 3-(4-Fluoro-1-oxoisoindolin-2-yl)piperidine-2,6-dione, 95%, (S)-3-(4-Fluoro-1-oxoisoindolin-2-yl)piperidine-2,6-dione, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.
(3S)-3-(7-fluoro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 1884230-69-6) is a chemical compound with the molecular formula C13H11FN2O3 and a molecular weight of 262.24 g/mol. IUPAC name: (3S)-3-(7-fluoro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: RSDXKDVFVKDIFY-JTQLQIEISA-N.
| Molecular formula | C13H11FN2O3 |
|---|---|
| Molecular weight | 262.24 g/mol |
| IUPAC name | (3S)-3-(7-fluoro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | RSDXKDVFVKDIFY-JTQLQIEISA-N |
| SMILES | C1CC(=O)NC(=O)[C@H]1N2CC3=C(C2=O)C=CC=C3F |
Computed by PubChem (NCBI)