CAS 2468780-87-0 appears in our catalog under these names: Lenalidomide-6-F 97%, 3-(6-fluoro-1,3-dihydro-1-oxo-2H-isoindol-2-yl)-2,6-piperidinedione, 98%, 98%, Lenalidomide-6-F, 99.77%, Lenalidomide-6-F, 96%. Offered by: Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 10mM/1mL, 100 mg.
3-(5-fluoro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 2468780-87-0) is a chemical compound with the molecular formula C13H11FN2O3 and a molecular weight of 262.24 g/mol. IUPAC name: 3-(5-fluoro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: HNAQSGYWVZTYEF-UHFFFAOYSA-N.
| Molecular formula | C13H11FN2O3 |
|---|---|
| Molecular weight | 262.24 g/mol |
| IUPAC name | 3-(5-fluoro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | HNAQSGYWVZTYEF-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=C(C=C3)F |
Computed by PubChem (NCBI)