Products 2324143-09-9
CAS 2324143-09-9 is the registry number for 4-Fluoro-2-(2-oxopiperidin-3-yl)isoindoline-1,3-dione, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
4-fluoro-2-(2-oxopiperidin-3-yl)isoindole-1,3-dione (CAS 2324143-09-9) is a chemical compound with the molecular formula C13H11FN2O3 and a molecular weight of 262.24 g/mol. IUPAC name: 4-fluoro-2-(2-oxopiperidin-3-yl)isoindole-1,3-dione. InChIKey: IIVHJKBFAAWAGQ-UHFFFAOYSA-N.
| Molecular formula | C13H11FN2O3 |
|---|---|
| Molecular weight | 262.24 g/mol |
| IUPAC name | 4-fluoro-2-(2-oxopiperidin-3-yl)isoindole-1,3-dione |
| InChIKey | IIVHJKBFAAWAGQ-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)NC1)N2C(=O)C3=C(C2=O)C(=CC=C3)F |
Computed by PubChem (NCBI)