CAS 1885-76-3 appears in our catalog under these names: 2–Methyl–6–nitrobenzonitrile, 2-Methyl-6-nitrobenzonitrile 98%, 2-Methyl-6-nitrobenzonitrile, 97%, 97%, 2-Methyl-6-nitrobenzonitrile, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg.
2-methyl-6-nitrobenzonitrile (CAS 1885-76-3) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 2-methyl-6-nitrobenzonitrile. InChIKey: BOTPDHNZLRJZOO-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 2-methyl-6-nitrobenzonitrile |
| InChIKey | BOTPDHNZLRJZOO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)