CAS 188561-56-0 is the registry number for Methyl 2-acetamido-3-(dimethylamino)acrylate, 95+%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
Methyl (E)-2-acetamido-3-(dimethylamino)prop-2-enoate (CAS 188561-56-0) is a chemical compound with the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. IUPAC name: methyl (E)-2-acetamido-3-(dimethylamino)prop-2-enoate. InChIKey: DUIYXFBABCZIPX-FNORWQNLSA-N.
| Molecular formula | C8H14N2O3 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | methyl (E)-2-acetamido-3-(dimethylamino)prop-2-enoate |
| InChIKey | DUIYXFBABCZIPX-FNORWQNLSA-N |
| SMILES | CC(=O)N/C(=C/N(C)C)/C(=O)OC |
Computed by PubChem (NCBI)