CAS 188690-82-6 is the registry number for Formoterol Impurity 59. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-2-bromo-1-(3-nitro-4-phenylmethoxyphenyl)ethanol (CAS 188690-82-6) is a chemical compound with the molecular formula C15H14BrNO4 and a molecular weight of 352.18 g/mol. IUPAC name: (1R)-2-bromo-1-(3-nitro-4-phenylmethoxyphenyl)ethanol. InChIKey: HQGAJOFIQLBIIM-AWEZNQCLSA-N.
| Molecular formula | C15H14BrNO4 |
|---|---|
| Molecular weight | 352.18 g/mol |
| IUPAC name | (1R)-2-bromo-1-(3-nitro-4-phenylmethoxyphenyl)ethanol |
| InChIKey | HQGAJOFIQLBIIM-AWEZNQCLSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)[C@H](CBr)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)