CAS 892874-41-8 is the registry number for 7-Bromoquinoline-2,3-dicarboxylic acid diethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Diethyl 7-bromoquinoline-2,3-dicarboxylate (CAS 892874-41-8) is a chemical compound with the molecular formula C15H14BrNO4 and a molecular weight of 352.18 g/mol. IUPAC name: diethyl 7-bromoquinoline-2,3-dicarboxylate. InChIKey: TWIQBJPCMUMTST-UHFFFAOYSA-N.
| Molecular formula | C15H14BrNO4 |
|---|---|
| Molecular weight | 352.18 g/mol |
| IUPAC name | diethyl 7-bromoquinoline-2,3-dicarboxylate |
| InChIKey | TWIQBJPCMUMTST-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C2C=C(C=CC2=C1)Br)C(=O)OCC |
Computed by PubChem (NCBI)