Products 892874-41-8

CAS 892874-41-8 is the registry number for 7-Bromoquinoline-2,3-dicarboxylic acid diethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Diethyl 7-bromoquinoline-2,3-dicarboxylate (CAS 892874-41-8) is a chemical compound with the molecular formula C15H14BrNO4 and a molecular weight of 352.18 g/mol. IUPAC name: diethyl 7-bromoquinoline-2,3-dicarboxylate. InChIKey: TWIQBJPCMUMTST-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14BrNO4
Molecular weight352.18 g/mol
IUPAC namediethyl 7-bromoquinoline-2,3-dicarboxylate
InChIKeyTWIQBJPCMUMTST-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(N=C2C=C(C=CC2=C1)Br)C(=O)OCC

Computed by PubChem (NCBI)