CAS 2757096-95-8 is the registry number for 4-Bromo-5-nitronaphthalen-2-yl pivalate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-bromo-5-nitronaphthalen-2-yl) 2,2-dimethylpropanoate (CAS 2757096-95-8) is a chemical compound with the molecular formula C15H14BrNO4 and a molecular weight of 352.18 g/mol. IUPAC name: (4-bromo-5-nitronaphthalen-2-yl) 2,2-dimethylpropanoate. InChIKey: JYVGPKNRMOYYIQ-UHFFFAOYSA-N.
| Molecular formula | C15H14BrNO4 |
|---|---|
| Molecular weight | 352.18 g/mol |
| IUPAC name | (4-bromo-5-nitronaphthalen-2-yl) 2,2-dimethylpropanoate |
| InChIKey | JYVGPKNRMOYYIQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OC1=CC(=C2C(=C1)C=CC=C2[N+](=O)[O-])Br |
Computed by PubChem (NCBI)