Products 1886990-13-1
CAS 1886990-13-1 is the registry number for 2-(4-(Difluoromethyl)phenyl)-2,2-difluoroethanol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
2-[4-(difluoromethyl)phenyl]-2,2-difluoroethanol (CAS 1886990-13-1) is a chemical compound with the molecular formula C9H8F4O and a molecular weight of 208.15 g/mol. IUPAC name: 2-[4-(difluoromethyl)phenyl]-2,2-difluoroethanol. InChIKey: ZMVZJRNNOJEEFC-UHFFFAOYSA-N.
| Molecular formula | C9H8F4O |
|---|---|
| Molecular weight | 208.15 g/mol |
| IUPAC name | 2-[4-(difluoromethyl)phenyl]-2,2-difluoroethanol |
| InChIKey | ZMVZJRNNOJEEFC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)F)C(CO)(F)F |
Computed by PubChem (NCBI)