CAS 1887197-42-3 appears in our catalog under these names: N'-((2S,3S)-2-(Benzyloxy)pentan-3-yl)formohydrazide oxalate, 95%, 2-((1S,2S)-1-Ethyl-2-(phenylmethoxy)propyl)hydrazinecarboxaldehyde Oxalate, N'-((2S,3S)-2-(Benzyloxy)pentan-3-yl)formohydrazide oxalate 97%, Hydrazinecarboxaldehyde, 2-[(1S,2S)-1-ethyl-2-(phenylmethoxy)propyl]-, ethanedioate (1:1), 97%, 97%. Offered by: Combi-blocks, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g, 10g, 2,5g, 50g, 100g, 250mg.
Oxalic acid;N-[[(2S,3S)-2-phenylmethoxypentan-3-yl]amino]formamide (CAS 1887197-42-3) is a chemical compound with the molecular formula C15H22N2O6 and a molecular weight of 326.34 g/mol. IUPAC name: oxalic acid;N-[[(2S,3S)-2-phenylmethoxypentan-3-yl]amino]formamide. InChIKey: NHBNQZOZYCCDJW-JZKFLRDJSA-N.
| Molecular formula | C15H22N2O6 |
|---|---|
| Molecular weight | 326.34 g/mol |
| IUPAC name | oxalic acid;N-[[(2S,3S)-2-phenylmethoxypentan-3-yl]amino]formamide |
| InChIKey | NHBNQZOZYCCDJW-JZKFLRDJSA-N |
| SMILES | CC[C@@H]([C@H](C)OCC1=CC=CC=C1)NNC=O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)