Products 84358-15-6

CAS 84358-15-6 is the registry number for Piperidine-1,4-dicarboxylic acid 4-tert-butyl ester 1-(2,5-dioxo-pyrrolidin-1-yl) ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 4-O-(2,5-dioxopyrrolidin-1-yl) piperidine-1,4-dicarboxylate (CAS 84358-15-6) is a chemical compound with the molecular formula C15H22N2O6 and a molecular weight of 326.34 g/mol. IUPAC name: 1-O-tert-butyl 4-O-(2,5-dioxopyrrolidin-1-yl) piperidine-1,4-dicarboxylate. InChIKey: ZOUQKBHJISIGOC-UHFFFAOYSA-N.

Identity
Molecular formulaC15H22N2O6
Molecular weight326.34 g/mol
IUPAC name1-O-tert-butyl 4-O-(2,5-dioxopyrrolidin-1-yl) piperidine-1,4-dicarboxylate
InChIKeyZOUQKBHJISIGOC-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(CC1)C(=O)ON2C(=O)CCC2=O

Computed by PubChem (NCBI)