Products 62952-06-1
CAS 62952-06-1 appears in our catalog under these names: DL-Lysine Acetylsalicylate, >95% (HPLC), DL–Lysine Acetylsalicylate, DL-Lysine Acetylsalicylate, >98.0%(HPLC)(T), Aspisol, 98%, 98%, Aspirin (DL-lysine). Offered by: TRC, GLPBio, TCI, Chemat, MedChemExpress. Available pack sizes: 100mg, 1g, 5g, 100g, 25g, 500g, 200mg, 1 g.
2-acetyloxybenzoic acid;2,6-diaminohexanoic acid (CAS 62952-06-1) is a chemical compound with the molecular formula C15H22N2O6 and a molecular weight of 326.34 g/mol. IUPAC name: 2-acetyloxybenzoic acid;2,6-diaminohexanoic acid. InChIKey: JJBCTCGUOQYZHK-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O6 |
|---|---|
| Molecular weight | 326.34 g/mol |
| IUPAC name | 2-acetyloxybenzoic acid;2,6-diaminohexanoic acid |
| InChIKey | JJBCTCGUOQYZHK-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=CC=C1C(=O)O.C(CCN)CC(C(=O)O)N |
Computed by PubChem (NCBI)