CAS 18873-95-5 appears in our catalog under these names: 5-Bromo-1,2-dimethyl-3-nitrobenzene 98%, 5-Bromo-1,2-dimethyl-3-nitrobenzene, 97%. Offered by: Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 10g, 100g.
5-bromo-1,2-dimethyl-3-nitrobenzene (CAS 18873-95-5) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 5-bromo-1,2-dimethyl-3-nitrobenzene. InChIKey: HPXSPJGSFHLODM-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 5-bromo-1,2-dimethyl-3-nitrobenzene |
| InChIKey | HPXSPJGSFHLODM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)