CAS 188792-70-3 appears in our catalog under these names: Ethyl 1-Boc-4-ethyl-4-piperidine carboxylate, 95-<97%, Ethyl 1-Boc-4-ethyl-4-piperidine carboxylate, ≥97-<99%, Ethyl 1-Boc-4-ethyl-4-piperidine carboxylate, >97%, >97%, 1-tert-Butyl 4-ethyl 4-ethylpiperidine-1,4-dicarboxylate, >97%. Offered by: Hoffman Fine Chemicals, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g, 100mg, 250mg.
1-O-tert-butyl 4-O-ethyl 4-ethylpiperidine-1,4-dicarboxylate (CAS 188792-70-3) is a chemical compound with the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl 4-ethylpiperidine-1,4-dicarboxylate. InChIKey: JLXSBKSGHPCYMR-UHFFFAOYSA-N.
| Molecular formula | C15H27NO4 |
|---|---|
| Molecular weight | 285.38 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-ethyl 4-ethylpiperidine-1,4-dicarboxylate |
| InChIKey | JLXSBKSGHPCYMR-UHFFFAOYSA-N |
| SMILES | CCC1(CCN(CC1)C(=O)OC(C)(C)C)C(=O)OCC |
Computed by PubChem (NCBI)