Products 188871-50-3
CAS 188871-50-3 is the registry number for 5-β-D-Ribofuranosyl-2(1H)-pyridinone. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-pyridin-2-one (CAS 188871-50-3) is a chemical compound with the molecular formula C10H13NO5 and a molecular weight of 227.21 g/mol. IUPAC name: 5-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-pyridin-2-one. InChIKey: FVBILTKUBHIPQL-UHFFFAOYSA-N.
| Molecular formula | C10H13NO5 |
|---|---|
| Molecular weight | 227.21 g/mol |
| IUPAC name | 5-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-pyridin-2-one |
| InChIKey | FVBILTKUBHIPQL-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC=C1C2C(C(C(O2)CO)O)O |
Computed by PubChem (NCBI)