CAS 1888764-74-6 is the registry number for 5-Bromo-4-methyl-3,4-dihydroquinoxalin-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-4-methyl-1,3-dihydroquinoxalin-2-one (CAS 1888764-74-6) is a chemical compound with the molecular formula C9H9BrN2O and a molecular weight of 241.08 g/mol. IUPAC name: 5-bromo-4-methyl-1,3-dihydroquinoxalin-2-one. InChIKey: WSTJUAJIQFQJSU-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 5-bromo-4-methyl-1,3-dihydroquinoxalin-2-one |
| InChIKey | WSTJUAJIQFQJSU-UHFFFAOYSA-N |
| SMILES | CN1CC(=O)NC2=C1C(=CC=C2)Br |
Computed by PubChem (NCBI)