CAS 1888929-48-3 appears in our catalog under these names: (3-Methylphenyl)methanesulfonyl fluoride, (3-Methylphenyl)methanesulfonyl fluoride, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 5g, 0,5g, 1g, 10g, 250mg, 100mg.
(3-methylphenyl)methanesulfonyl fluoride (CAS 1888929-48-3) is a chemical compound with the molecular formula C8H9FO2S and a molecular weight of 188.22 g/mol. IUPAC name: (3-methylphenyl)methanesulfonyl fluoride. InChIKey: VZHDNFCQZFKSJK-UHFFFAOYSA-N.
| Molecular formula | C8H9FO2S |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | (3-methylphenyl)methanesulfonyl fluoride |
| InChIKey | VZHDNFCQZFKSJK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)CS(=O)(=O)F |
Computed by PubChem (NCBI)