Products 86146-00-1

CAS 86146-00-1 is the registry number for 3,5-Dimethylbenzenesulfonyl fluoride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

3,5-dimethylbenzenesulfonyl fluoride (CAS 86146-00-1) is a chemical compound with the molecular formula C8H9FO2S and a molecular weight of 188.22 g/mol. IUPAC name: 3,5-dimethylbenzenesulfonyl fluoride. InChIKey: USDUCJJANRAWTQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9FO2S
Molecular weight188.22 g/mol
IUPAC name3,5-dimethylbenzenesulfonyl fluoride
InChIKeyUSDUCJJANRAWTQ-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1)S(=O)(=O)F)C

Computed by PubChem (NCBI)