CAS 86146-00-1 is the registry number for 3,5-Dimethylbenzenesulfonyl fluoride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
3,5-dimethylbenzenesulfonyl fluoride (CAS 86146-00-1) is a chemical compound with the molecular formula C8H9FO2S and a molecular weight of 188.22 g/mol. IUPAC name: 3,5-dimethylbenzenesulfonyl fluoride. InChIKey: USDUCJJANRAWTQ-UHFFFAOYSA-N.
| Molecular formula | C8H9FO2S |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | 3,5-dimethylbenzenesulfonyl fluoride |
| InChIKey | USDUCJJANRAWTQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)S(=O)(=O)F)C |
Computed by PubChem (NCBI)