CAS 60218-20-4 is the registry number for 2,3-Dimethylbenzenesulfonyl fluoride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3-dimethylbenzenesulfonyl fluoride (CAS 60218-20-4) is a chemical compound with the molecular formula C8H9FO2S and a molecular weight of 188.22 g/mol. IUPAC name: 2,3-dimethylbenzenesulfonyl fluoride. InChIKey: AMIYLONQTDBHOE-UHFFFAOYSA-N.
| Molecular formula | C8H9FO2S |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | 2,3-dimethylbenzenesulfonyl fluoride |
| InChIKey | AMIYLONQTDBHOE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)S(=O)(=O)F)C |
Computed by PubChem (NCBI)