Products 60218-20-4

CAS 60218-20-4 is the registry number for 2,3-Dimethylbenzenesulfonyl fluoride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2,3-dimethylbenzenesulfonyl fluoride (CAS 60218-20-4) is a chemical compound with the molecular formula C8H9FO2S and a molecular weight of 188.22 g/mol. IUPAC name: 2,3-dimethylbenzenesulfonyl fluoride. InChIKey: AMIYLONQTDBHOE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9FO2S
Molecular weight188.22 g/mol
IUPAC name2,3-dimethylbenzenesulfonyl fluoride
InChIKeyAMIYLONQTDBHOE-UHFFFAOYSA-N
SMILESCC1=C(C(=CC=C1)S(=O)(=O)F)C

Computed by PubChem (NCBI)