Products 1888942-58-2
CAS 1888942-58-2 is the registry number for 3-Hydroxy-3-methyl-1-phenylcyclobutanecarboxylic Acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-hydroxy-3-methyl-1-phenylcyclobutane-1-carboxylic acid (CAS 1888942-58-2) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 3-hydroxy-3-methyl-1-phenylcyclobutane-1-carboxylic acid. InChIKey: GLFMVNOVSSFEKM-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 3-hydroxy-3-methyl-1-phenylcyclobutane-1-carboxylic acid |
| InChIKey | GLFMVNOVSSFEKM-UHFFFAOYSA-N |
| SMILES | CC1(CC(C1)(C2=CC=CC=C2)C(=O)O)O |
Computed by PubChem (NCBI)