CAS 1888954-28-6 is the registry number for 8-Fluoro-2,9-dihydro-1H-pyrido[3,4-b]indol-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-fluoro-2,9-dihydropyrido[3,4-b]indol-1-one (CAS 1888954-28-6) is a chemical compound with the molecular formula C11H7FN2O and a molecular weight of 202.18 g/mol. IUPAC name: 8-fluoro-2,9-dihydropyrido[3,4-b]indol-1-one. InChIKey: WZHCJEUSZAXKSO-UHFFFAOYSA-N.
| Molecular formula | C11H7FN2O |
|---|---|
| Molecular weight | 202.18 g/mol |
| IUPAC name | 8-fluoro-2,9-dihydropyrido[3,4-b]indol-1-one |
| InChIKey | WZHCJEUSZAXKSO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)NC3=C2C=CNC3=O |
Computed by PubChem (NCBI)