CAS 22087-28-1 is the registry number for 2-(2-(4-Fluorophenyl)-1,3-oxazol-4-yl)acetonitrile. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]acetonitrile (CAS 22087-28-1) is a chemical compound with the molecular formula C11H7FN2O and a molecular weight of 202.18 g/mol. IUPAC name: 2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]acetonitrile. InChIKey: WAUSXDAVLUXHPM-UHFFFAOYSA-N.
| Molecular formula | C11H7FN2O |
|---|---|
| Molecular weight | 202.18 g/mol |
| IUPAC name | 2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]acetonitrile |
| InChIKey | WAUSXDAVLUXHPM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CO2)CC#N)F |
Computed by PubChem (NCBI)