CAS 748810-25-5 is the registry number for TAK438 Impurity 99. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-[2-(4-fluorophenyl)-2-oxoethyl]propanedinitrile (CAS 748810-25-5) is a chemical compound with the molecular formula C11H7FN2O and a molecular weight of 202.18 g/mol. IUPAC name: 2-[2-(4-fluorophenyl)-2-oxoethyl]propanedinitrile. InChIKey: SNEOSXIUTYPDSA-UHFFFAOYSA-N.
| Molecular formula | C11H7FN2O |
|---|---|
| Molecular weight | 202.18 g/mol |
| IUPAC name | 2-[2-(4-fluorophenyl)-2-oxoethyl]propanedinitrile |
| InChIKey | SNEOSXIUTYPDSA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CC(C#N)C#N)F |
Computed by PubChem (NCBI)