Products 748810-25-5

CAS 748810-25-5 is the registry number for TAK438 Impurity 99. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

2-[2-(4-fluorophenyl)-2-oxoethyl]propanedinitrile (CAS 748810-25-5) is a chemical compound with the molecular formula C11H7FN2O and a molecular weight of 202.18 g/mol. IUPAC name: 2-[2-(4-fluorophenyl)-2-oxoethyl]propanedinitrile. InChIKey: SNEOSXIUTYPDSA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7FN2O
Molecular weight202.18 g/mol
IUPAC name2-[2-(4-fluorophenyl)-2-oxoethyl]propanedinitrile
InChIKeySNEOSXIUTYPDSA-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(=O)CC(C#N)C#N)F

Computed by PubChem (NCBI)