Products 1888958-65-3

CAS 1888958-65-3 is the registry number for 4-Methoxy-n,3,5-trimethylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-methoxy-N,3,5-trimethylbenzamide (CAS 1888958-65-3) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 4-methoxy-N,3,5-trimethylbenzamide. InChIKey: XSBFDKVJRYGCHJ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15NO2
Molecular weight193.24 g/mol
IUPAC name4-methoxy-N,3,5-trimethylbenzamide
InChIKeyXSBFDKVJRYGCHJ-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1OC)C)C(=O)NC

Computed by PubChem (NCBI)