CAS 189000-91-7 appears in our catalog under these names: (4,4'-Bipyridine)-2,2'-diamine, [4,4'-Bipyridine]-2,2'-diamine, 95%, 95%. Offered by: TRC, Chemat. Available pack sizes: 1g, 50mg, 100mg, 250mg.
4-(2-amino-4-pyridinyl)pyridin-2-amine (CAS 189000-91-7) is a chemical compound with the molecular formula C10H10N4 and a molecular weight of 186.21 g/mol. IUPAC name: 4-(2-amino-4-pyridinyl)pyridin-2-amine. InChIKey: ZYRCSFAMFIQCHY-UHFFFAOYSA-N.
| Molecular formula | C10H10N4 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 4-(2-amino-4-pyridinyl)pyridin-2-amine |
| InChIKey | ZYRCSFAMFIQCHY-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1C2=CC(=NC=C2)N)N |
Computed by PubChem (NCBI)