CAS 189005-44-5 appears in our catalog under these names: Zolpidem Impurity 8, Zolpidem Acid, >95% (HPLC), 2-(6-Methyl-2-(4-methylphenyl)imidazo(1,2-a)pyridin-3-yl)acetic Acid, 6-Methyl-2-(4-methylphenyl)imidazol(1,2-a)-pyridine-3-acetic acid, Zolpidic acid 98%. Offered by: Chemat Brand, TRC, Mikromol, Biosynth, Ambeed. Available pack sizes: on request, 10g, 1g, 5g, 25mg, 100mg, 2g, 50g.
2-[6-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]acetic acid (CAS 189005-44-5) is a chemical compound with the molecular formula C17H16N2O2 and a molecular weight of 280.32 g/mol. IUPAC name: 2-[6-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]acetic acid. InChIKey: JHGHLTNIQXXXNV-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O2 |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | 2-[6-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]acetic acid |
| InChIKey | JHGHLTNIQXXXNV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(N3C=C(C=CC3=N2)C)CC(=O)O |
Computed by PubChem (NCBI)