Products 1890587-25-3

CAS 1890587-25-3 is the registry number for 3-((3H-[1,2,3]Triazolo[4,5-b]pyridin-3-yl)methyl)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(triazolo[4,5-b]pyridin-3-ylmethyl)thiolane 1,1-dioxide (CAS 1890587-25-3) is a chemical compound with the molecular formula C10H12N4O2S and a molecular weight of 252.30 g/mol. IUPAC name: 3-(triazolo[4,5-b]pyridin-3-ylmethyl)thiolane 1,1-dioxide. InChIKey: XUDNZUSUAQIJRD-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12N4O2S
Molecular weight252.30 g/mol
IUPAC name3-(triazolo[4,5-b]pyridin-3-ylmethyl)thiolane 1,1-dioxide
InChIKeyXUDNZUSUAQIJRD-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CC1CN2C3=C(C=CC=N3)N=N2

Computed by PubChem (NCBI)