CAS 1891319-98-4 is the registry number for Noradrenaline (Norepinephrine) Impurity 24. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-1-(2,3-dihydroxyphenyl)ethanone (CAS 1891319-98-4) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2-amino-1-(2,3-dihydroxyphenyl)ethanone. InChIKey: ZNDKVRMHECOXLA-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2-amino-1-(2,3-dihydroxyphenyl)ethanone |
| InChIKey | ZNDKVRMHECOXLA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)O)C(=O)CN |
Computed by PubChem (NCBI)