Products 189152-72-5

CAS 189152-72-5 is the registry number for Methyl 2-sulfanyl-1,3-thiazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 2-sulfanylidene-3H-1,3-thiazole-4-carboxylate (CAS 189152-72-5) is a chemical compound with the molecular formula C5H5NO2S2 and a molecular weight of 175.2 g/mol. IUPAC name: methyl 2-sulfanylidene-3H-1,3-thiazole-4-carboxylate. InChIKey: IBEZFQXSZFDKNX-UHFFFAOYSA-N.

Identity
Molecular formulaC5H5NO2S2
Molecular weight175.2 g/mol
IUPAC namemethyl 2-sulfanylidene-3H-1,3-thiazole-4-carboxylate
InChIKeyIBEZFQXSZFDKNX-UHFFFAOYSA-N
SMILESCOC(=O)C1=CSC(=S)N1

Computed by PubChem (NCBI)