Products 635283-90-8

CAS 635283-90-8 is the registry number for 2-(Methylsulfanyl)-1,3-thiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-methylsulfanyl-1,3-thiazole-5-carboxylic acid (CAS 635283-90-8) is a chemical compound with the molecular formula C5H5NO2S2 and a molecular weight of 175.2 g/mol. IUPAC name: 2-methylsulfanyl-1,3-thiazole-5-carboxylic acid. InChIKey: BWCOHLFKFURXKL-UHFFFAOYSA-N.

Identity
Molecular formulaC5H5NO2S2
Molecular weight175.2 g/mol
IUPAC name2-methylsulfanyl-1,3-thiazole-5-carboxylic acid
InChIKeyBWCOHLFKFURXKL-UHFFFAOYSA-N
SMILESCSC1=NC=C(S1)C(=O)O

Computed by PubChem (NCBI)