Products 571155-23-2

CAS 571155-23-2 is the registry number for 3-Isothiocyanato-2,5-dihydrothiophene 1,1-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

3-isothiocyanato-2,5-dihydrothiophene 1,1-dioxide (CAS 571155-23-2) is a chemical compound with the molecular formula C5H5NO2S2 and a molecular weight of 175.2 g/mol. IUPAC name: 3-isothiocyanato-2,5-dihydrothiophene 1,1-dioxide. InChIKey: CBOYHLGOMXRMGE-UHFFFAOYSA-N.

Identity
Molecular formulaC5H5NO2S2
Molecular weight175.2 g/mol
IUPAC name3-isothiocyanato-2,5-dihydrothiophene 1,1-dioxide
InChIKeyCBOYHLGOMXRMGE-UHFFFAOYSA-N
SMILESC1C=C(CS1(=O)=O)N=C=S

Computed by PubChem (NCBI)