CAS 1892248-37-1 is the registry number for 3-Bromo-5-ethyl-2-fluorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
3-bromo-5-ethyl-2-fluorobenzoic acid (CAS 1892248-37-1) is a chemical compound with the molecular formula C9H8BrFO2 and a molecular weight of 247.06 g/mol. IUPAC name: 3-bromo-5-ethyl-2-fluorobenzoic acid. InChIKey: BMJZEDPCIGEMCN-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFO2 |
|---|---|
| Molecular weight | 247.06 g/mol |
| IUPAC name | 3-bromo-5-ethyl-2-fluorobenzoic acid |
| InChIKey | BMJZEDPCIGEMCN-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C(=C1)Br)F)C(=O)O |
Computed by PubChem (NCBI)