Products 1892248-37-1

CAS 1892248-37-1 is the registry number for 3-Bromo-5-ethyl-2-fluorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-bromo-5-ethyl-2-fluorobenzoic acid (CAS 1892248-37-1) is a chemical compound with the molecular formula C9H8BrFO2 and a molecular weight of 247.06 g/mol. IUPAC name: 3-bromo-5-ethyl-2-fluorobenzoic acid. InChIKey: BMJZEDPCIGEMCN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8BrFO2
Molecular weight247.06 g/mol
IUPAC name3-bromo-5-ethyl-2-fluorobenzoic acid
InChIKeyBMJZEDPCIGEMCN-UHFFFAOYSA-N
SMILESCCC1=CC(=C(C(=C1)Br)F)C(=O)O

Computed by PubChem (NCBI)