CAS 189250-15-5 is the registry number for N-Benzyl-6-chloro-1,3,5-triazine-2,4-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-N-benzyl-6-chloro-1,3,5-triazine-2,4-diamine (CAS 189250-15-5) is a chemical compound with the molecular formula C10H10ClN5 and a molecular weight of 235.67 g/mol. IUPAC name: 2-N-benzyl-6-chloro-1,3,5-triazine-2,4-diamine. InChIKey: XSDWOOUKAMFWTM-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN5 |
|---|---|
| Molecular weight | 235.67 g/mol |
| IUPAC name | 2-N-benzyl-6-chloro-1,3,5-triazine-2,4-diamine |
| InChIKey | XSDWOOUKAMFWTM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=NC(=NC(=N2)N)Cl |
Computed by PubChem (NCBI)