Products 882765-46-0
CAS 882765-46-0 is the registry number for 6-Chloro-N4-(pyridin-3-ylmethyl)pyrimidine-4,5-diamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-4-N-(pyridin-3-ylmethyl)pyrimidine-4,5-diamine (CAS 882765-46-0) is a chemical compound with the molecular formula C10H10ClN5 and a molecular weight of 235.67 g/mol. IUPAC name: 6-chloro-4-N-(pyridin-3-ylmethyl)pyrimidine-4,5-diamine. InChIKey: GWKFNDAKLAWEKP-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN5 |
|---|---|
| Molecular weight | 235.67 g/mol |
| IUPAC name | 6-chloro-4-N-(pyridin-3-ylmethyl)pyrimidine-4,5-diamine |
| InChIKey | GWKFNDAKLAWEKP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)CNC2=C(C(=NC=N2)Cl)N |
Computed by PubChem (NCBI)