CAS 30355-60-3 appears in our catalog under these names: 6-(Chloromethyl)-n-phenyl-1,3,5-triazine-2,4-diamine, 95%, 6-(Chloromethyl)-N2-phenyl-1,3,5-triazine-2,4-diamine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
6-(chloromethyl)-2-N-phenyl-1,3,5-triazine-2,4-diamine (CAS 30355-60-3) is a chemical compound with the molecular formula C10H10ClN5 and a molecular weight of 235.67 g/mol. IUPAC name: 6-(chloromethyl)-2-N-phenyl-1,3,5-triazine-2,4-diamine. InChIKey: ZEXYPLRLARKYLF-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN5 |
|---|---|
| Molecular weight | 235.67 g/mol |
| IUPAC name | 6-(chloromethyl)-2-N-phenyl-1,3,5-triazine-2,4-diamine |
| InChIKey | ZEXYPLRLARKYLF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC(=NC(=N2)N)CCl |
Computed by PubChem (NCBI)